C24H24O3S — CID 177499409
(2S,4R,5R)-2-methyl-4-(4-methylphenyl)sulfonyl-2,5-diphenyloxolane (PubChem CID 177499409) has the molecular formula C24H24O3S and a molecular weight of 392.52 g/mol. Its IUPAC name is (2S,4R,5R)-2-methyl-4-(4-methylphenyl)sulfonyl-2,5-diphenyloxolane.
| Compound Name | (2S,4R,5R)-2-methyl-4-(4-methylphenyl)sulfonyl-2,5-diphenyloxolane |
|---|---|
| PubChem CID | 177499409 |
| Molecular Formula | C24H24O3S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (2S,4R,5R)-2-methyl-4-(4-methylphenyl)sulfonyl-2,5-diphenyloxolane |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2C[C@@](C)(c3ccccc3)O[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24O3S/c1-18-13-15-21(16-14-18)28(25,26)22-17-24(2,20-11-7-4-8-12-20)27-23(22)19-9-5-3-6-10-19/h3-16,22-23H,17H2,1-2H3/t22-,23-,24+/m1/s1 |
| InChIKey | XYQSLXKWFQGFLZ-SMIHKQSGSA-N |
| XLogP | 5.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |