C22H20O2S2 — CID 23739681
1,4-dimethyl-9-(4-methylphenyl)sulfonyl-9H-thioxanthene (PubChem CID 23739681) has the molecular formula C22H20O2S2 and a molecular weight of 380.53 g/mol. Its IUPAC name is 1,4-dimethyl-9-(4-methylphenyl)sulfonyl-9H-thioxanthene.
| Compound Name | 1,4-dimethyl-9-(4-methylphenyl)sulfonyl-9H-thioxanthene |
|---|---|
| PubChem CID | 23739681 |
| Molecular Formula | C22H20O2S2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 1,4-dimethyl-9-(4-methylphenyl)sulfonyl-9H-thioxanthene |
| SMILES | Cc1ccc(S(=O)(=O)C2c3ccccc3Sc3c(C)ccc(C)c32)cc1 |
| InChI | InChI=1S/C22H20O2S2/c1-14-8-12-17(13-9-14)26(23,24)22-18-6-4-5-7-19(18)25-21-16(3)11-10-15(2)20(21)22/h4-13,22H,1-3H3 |
| InChIKey | XKKJSKRHESNKQC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |