C21H35NO8 — CID 11796834
[(13R)-13-[(5R,6R,7R,7aR)-6,7-dihydroxy-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-13-hydroxy-5-oxotridecyl] acetate (PubChem CID 11796834) has the molecular formula C21H35NO8 and a molecular weight of 429.51 g/mol. Its IUPAC name is [(13R)-13-[(5R,6R,7R,7aR)-6,7-dihydroxy-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-13-hydroxy-5-oxotridecyl] acetate.
| Compound Name | [(13R)-13-[(5R,6R,7R,7aR)-6,7-dihydroxy-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-13-hydroxy-5-oxotridecyl] acetate |
|---|---|
| PubChem CID | 11796834 |
| Molecular Formula | C21H35NO8 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | [(13R)-13-[(5R,6R,7R,7aR)-6,7-dihydroxy-3-oxo-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-yl]-13-hydroxy-5-oxotridecyl] acetate |
| SMILES | CC(=O)OCCCCC(=O)CCCCCCC[C@@H](O)[C@@H]1[C@@H](O)[C@H](O)[C@H]2COC(=O)N12 |
| InChI | InChI=1S/C21H35NO8/c1-14(23)29-12-8-7-10-15(24)9-5-3-2-4-6-11-17(25)18-20(27)19(26)16-13-30-21(28)22(16)18/h16-20,25-27H,2-13H2,1H3/t16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | NTJIHIMLOKPRSA-LASHMREHSA-N |
| XLogP | 1.31 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|