C24H16ClN5O3S — CID 11799240
1-[5-(carbazol-9-ylmethyl)-1,3,4-thiadiazol-2-yl]-3-chloro-4-(2-nitrophenyl)azetidin-2-one (PubChem CID 11799240) has the molecular formula C24H16ClN5O3S and a molecular weight of 489.94 g/mol. Its IUPAC name is 1-[5-(carbazol-9-ylmethyl)-1,3,4-thiadiazol-2-yl]-3-chloro-4-(2-nitrophenyl)azetidin-2-one.
| Compound Name | 1-[5-(carbazol-9-ylmethyl)-1,3,4-thiadiazol-2-yl]-3-chloro-4-(2-nitrophenyl)azetidin-2-one |
|---|---|
| PubChem CID | 11799240 |
| Molecular Formula | C24H16ClN5O3S |
| Molecular Weight | 489.94 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 1-[5-(carbazol-9-ylmethyl)-1,3,4-thiadiazol-2-yl]-3-chloro-4-(2-nitrophenyl)azetidin-2-one |
| SMILES | O=C1C(Cl)C(c2ccccc2[N+](=O)[O-])N1c1nnc(Cn2c3ccccc3c3ccccc32)s1 |
| InChI | InChI=1S/C24H16ClN5O3S/c25-21-22(16-9-3-6-12-19(16)30(32)33)29(23(21)31)24-27-26-20(34-24)13-28-17-10-4-1-7-14(17)15-8-2-5-11-18(15)28/h1-12,21-22H,13H2 |
| InChIKey | DEYXQMAMOPJCMO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.94 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|