C19H11ClN6O5S3 — CID 11203435
1-[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]-3-chloro-4-(2,4-dinitrophenyl)azetidin-2-one (PubChem CID 11203435) has the molecular formula C19H11ClN6O5S3 and a molecular weight of 534.99 g/mol. Its IUPAC name is 1-[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]-3-chloro-4-(2,4-dinitrophenyl)azetidin-2-one.
| Compound Name | 1-[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]-3-chloro-4-(2,4-dinitrophenyl)azetidin-2-one |
|---|---|
| PubChem CID | 11203435 |
| Molecular Formula | C19H11ClN6O5S3 |
| Molecular Weight | 534.99 g/mol |
| Exact Mass | 533.96 |
| IUPAC Name | 1-[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]-3-chloro-4-(2,4-dinitrophenyl)azetidin-2-one |
| SMILES | O=C1C(Cl)C(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])N1c1nnc(CSc2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C19H11ClN6O5S3/c20-15-16(10-6-5-9(25(28)29)7-12(10)26(30)31)24(17(15)27)18-23-22-14(34-18)8-32-19-21-11-3-1-2-4-13(11)33-19/h1-7,15-16H,8H2 |
| InChIKey | FVIIXBSPDKBAGV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 145.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.99 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|