C25H15N7O10S3 — CID 11433831
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(5Z)-2-(2,4-dinitrophenyl)-5-[(2,4-dinitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 11433831) has the molecular formula C25H15N7O10S3 and a molecular weight of 669.63 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(5Z)-2-(2,4-dinitrophenyl)-5-[(2,4-dinitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(5Z)-2-(2,4-dinitrophenyl)-5-[(2,4-dinitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 11433831 |
| Molecular Formula | C25H15N7O10S3 |
| Molecular Weight | 669.63 g/mol |
| Exact Mass | 669.00 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(5Z)-2-(2,4-dinitrophenyl)-5-[(2,4-dinitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2s1)NN1C(=O)/C(=C/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])SC1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H15N7O10S3/c33-22(12-43-25-26-17-3-1-2-4-20(17)45-25)27-28-23(34)21(9-13-5-6-14(29(35)36)10-18(13)31(39)40)44-24(28)16-8-7-15(30(37)38)11-19(16)32(41)42/h1-11,24H,12H2,(H,27,33)/b21-9- |
| InChIKey | NQJDURWGFRCIEB-NKVSQWTQSA-N |
| XLogP | 5.37 |
| TPSA | 234.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|