C25H19N3O4S3 — CID 11409844
S-(1,3-benzothiazol-2-yl) 2-[[(5E)-2-(2-hydroxyphenyl)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]amino]ethanethioate (PubChem CID 11409844) has the molecular formula C25H19N3O4S3 and a molecular weight of 521.65 g/mol. Its IUPAC name is S-(1,3-benzothiazol-2-yl) 2-[[(5E)-2-(2-hydroxyphenyl)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]amino]ethanethioate.
| Compound Name | S-(1,3-benzothiazol-2-yl) 2-[[(5E)-2-(2-hydroxyphenyl)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]amino]ethanethioate |
|---|---|
| PubChem CID | 11409844 |
| Molecular Formula | C25H19N3O4S3 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | S-(1,3-benzothiazol-2-yl) 2-[[(5E)-2-(2-hydroxyphenyl)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]amino]ethanethioate |
| SMILES | O=C(CNN1C(=O)/C(=C\c2ccccc2O)SC1c1ccccc1O)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C25H19N3O4S3/c29-18-10-4-1-7-15(18)13-21-23(32)28(24(33-21)16-8-2-5-11-19(16)30)26-14-22(31)35-25-27-17-9-3-6-12-20(17)34-25/h1-13,24,26,29-30H,14H2/b21-13+ |
| InChIKey | KCQLFPXDMWTDFW-FYJGNVAPSA-N |
| XLogP | 5.15 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|