C25H17Cl2N3O2S3 — CID 11203754
S-(1,3-benzothiazol-2-yl) 2-[[(5E)-2-(4-chlorophenyl)-5-[(4-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]amino]ethanethioate (PubChem CID 11203754) has the molecular formula C25H17Cl2N3O2S3 and a molecular weight of 558.54 g/mol. Its IUPAC name is S-(1,3-benzothiazol-2-yl) 2-[[(5E)-2-(4-chlorophenyl)-5-[(4-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]amino]ethanethioate.
| Compound Name | S-(1,3-benzothiazol-2-yl) 2-[[(5E)-2-(4-chlorophenyl)-5-[(4-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]amino]ethanethioate |
|---|---|
| PubChem CID | 11203754 |
| Molecular Formula | C25H17Cl2N3O2S3 |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 556.99 |
| IUPAC Name | S-(1,3-benzothiazol-2-yl) 2-[[(5E)-2-(4-chlorophenyl)-5-[(4-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]amino]ethanethioate |
| SMILES | O=C(CNN1C(=O)/C(=C\c2ccc(Cl)cc2)SC1c1ccc(Cl)cc1)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C25H17Cl2N3O2S3/c26-17-9-5-15(6-10-17)13-21-23(32)30(24(33-21)16-7-11-18(27)12-8-16)28-14-22(31)35-25-29-19-3-1-2-4-20(19)34-25/h1-13,24,28H,14H2/b21-13+ |
| InChIKey | JHGMLGMIOUGWMU-FYJGNVAPSA-N |
| XLogP | 7.04 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|