C18H14BrN3O2S3 — CID 11340585
S-(1,3-benzothiazol-2-yl) 2-[[2-(4-bromophenyl)-4-oxo-1,3-thiazolidin-3-yl]amino]ethanethioate (PubChem CID 11340585) has the molecular formula C18H14BrN3O2S3 and a molecular weight of 480.43 g/mol. Its IUPAC name is S-(1,3-benzothiazol-2-yl) 2-[[2-(4-bromophenyl)-4-oxo-1,3-thiazolidin-3-yl]amino]ethanethioate.
| Compound Name | S-(1,3-benzothiazol-2-yl) 2-[[2-(4-bromophenyl)-4-oxo-1,3-thiazolidin-3-yl]amino]ethanethioate |
|---|---|
| PubChem CID | 11340585 |
| Molecular Formula | C18H14BrN3O2S3 |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 478.94 |
| IUPAC Name | S-(1,3-benzothiazol-2-yl) 2-[[2-(4-bromophenyl)-4-oxo-1,3-thiazolidin-3-yl]amino]ethanethioate |
| SMILES | O=C(CNN1C(=O)CSC1c1ccc(Br)cc1)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H14BrN3O2S3/c19-12-7-5-11(6-8-12)17-22(15(23)10-25-17)20-9-16(24)27-18-21-13-3-1-2-4-14(13)26-18/h1-8,17,20H,9-10H2 |
| InChIKey | SAEDPTWRMQNREW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|