C18H15N3O3S3 — CID 11441465
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(2-hydroxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 11441465) has the molecular formula C18H15N3O3S3 and a molecular weight of 417.54 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(2-hydroxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(2-hydroxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 11441465 |
| Molecular Formula | C18H15N3O3S3 |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-(2-hydroxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2s1)NN1C(=O)CSC1c1ccccc1O |
| InChI | InChI=1S/C18H15N3O3S3/c22-13-7-3-1-5-11(13)17-21(16(24)10-25-17)20-15(23)9-26-18-19-12-6-2-4-8-14(12)27-18/h1-8,17,22H,9-10H2,(H,20,23) |
| InChIKey | DNIARYKLLCJRHV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|