C16H11BrN2OS2 — CID 3332829
3-(1,3-benzothiazol-2-yl)-2-(4-bromophenyl)-1,3-thiazolidin-4-one (PubChem CID 3332829) has the molecular formula C16H11BrN2OS2 and a molecular weight of 391.32 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-2-(4-bromophenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-2-(4-bromophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3332829 |
| Molecular Formula | C16H11BrN2OS2 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-2-(4-bromophenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc(Br)cc2)N1c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H11BrN2OS2/c17-11-7-5-10(6-8-11)15-19(14(20)9-21-15)16-18-12-3-1-2-4-13(12)22-16/h1-8,15H,9H2 |
| InChIKey | URVIYCUUDYECQL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |