C23H14ClN3OS2 — CID 11351344
(5Z)-2-(1,3-benzothiazol-2-ylsulfanyl)-5-[(4-chlorophenyl)methylidene]-3-phenylimidazol-4-one (PubChem CID 11351344) has the molecular formula C23H14ClN3OS2 and a molecular weight of 447.97 g/mol. Its IUPAC name is (5Z)-2-(1,3-benzothiazol-2-ylsulfanyl)-5-[(4-chlorophenyl)methylidene]-3-phenylimidazol-4-one.
| Compound Name | (5Z)-2-(1,3-benzothiazol-2-ylsulfanyl)-5-[(4-chlorophenyl)methylidene]-3-phenylimidazol-4-one |
|---|---|
| PubChem CID | 11351344 |
| Molecular Formula | C23H14ClN3OS2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | (5Z)-2-(1,3-benzothiazol-2-ylsulfanyl)-5-[(4-chlorophenyl)methylidene]-3-phenylimidazol-4-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)cc2)N=C(Sc2nc3ccccc3s2)N1c1ccccc1 |
| InChI | InChI=1S/C23H14ClN3OS2/c24-16-12-10-15(11-13-16)14-19-21(28)27(17-6-2-1-3-7-17)22(25-19)30-23-26-18-8-4-5-9-20(18)29-23/h1-14H/b19-14- |
| InChIKey | DGOLBMLQZFWWPV-RGEXLXHISA-N |
| XLogP | 6.49 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|