C19H12ClN5O3S3 — CID 15535950
1-[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]-3-chloro-4-(2-nitrophenyl)azetidin-2-one (PubChem CID 15535950) has the molecular formula C19H12ClN5O3S3 and a molecular weight of 489.99 g/mol. Its IUPAC name is 1-[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]-3-chloro-4-(2-nitrophenyl)azetidin-2-one.
| Compound Name | 1-[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]-3-chloro-4-(2-nitrophenyl)azetidin-2-one |
|---|---|
| PubChem CID | 15535950 |
| Molecular Formula | C19H12ClN5O3S3 |
| Molecular Weight | 489.99 g/mol |
| Exact Mass | 488.98 |
| IUPAC Name | 1-[5-(1,3-benzothiazol-2-ylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]-3-chloro-4-(2-nitrophenyl)azetidin-2-one |
| SMILES | O=C1C(Cl)C(c2ccccc2[N+](=O)[O-])N1c1nnc(CSc2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C19H12ClN5O3S3/c20-15-16(10-5-1-3-7-12(10)25(27)28)24(17(15)26)18-23-22-14(31-18)9-29-19-21-11-6-2-4-8-13(11)30-19/h1-8,15-16H,9H2 |
| InChIKey | QWXAJSUFYKKWFZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 102.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.99 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|