C16H11N5O2S2 — CID 57382660
2-[[1-(3-nitrophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole (PubChem CID 57382660) has the molecular formula C16H11N5O2S2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-[[1-(3-nitrophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[[1-(3-nitrophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 57382660 |
| Molecular Formula | C16H11N5O2S2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 2-[[1-(3-nitrophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1cccc(-n2cc(CSc3nc4ccccc4s3)nn2)c1 |
| InChI | InChI=1S/C16H11N5O2S2/c22-21(23)13-5-3-4-12(8-13)20-9-11(18-19-20)10-24-16-17-14-6-1-2-7-15(14)25-16/h1-9H,10H2 |
| InChIKey | UQZAIWDSVIOJEB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|