C33H30O5 — CID 11799736
[4-[(E)-2-[5-[(E)-2-(4-acetyloxyphenyl)ethenyl]-6-propoxynaphthalen-2-yl]ethenyl]phenyl] acetate (PubChem CID 11799736) has the molecular formula C33H30O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is [4-[(E)-2-[5-[(E)-2-(4-acetyloxyphenyl)ethenyl]-6-propoxynaphthalen-2-yl]ethenyl]phenyl] acetate.
| Compound Name | [4-[(E)-2-[5-[(E)-2-(4-acetyloxyphenyl)ethenyl]-6-propoxynaphthalen-2-yl]ethenyl]phenyl] acetate |
|---|---|
| PubChem CID | 11799736 |
| Molecular Formula | C33H30O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [4-[(E)-2-[5-[(E)-2-(4-acetyloxyphenyl)ethenyl]-6-propoxynaphthalen-2-yl]ethenyl]phenyl] acetate |
| SMILES | CCCOc1ccc2cc(/C=C/c3ccc(OC(C)=O)cc3)ccc2c1/C=C/c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C33H30O5/c1-4-21-36-33-20-13-28-22-27(6-5-25-7-14-29(15-8-25)37-23(2)34)12-18-31(28)32(33)19-11-26-9-16-30(17-10-26)38-24(3)35/h5-20,22H,4,21H2,1-3H3/b6-5+,19-11+ |
| InChIKey | LNJYUESUKMXSHW-TYJVLPEUSA-N |
| XLogP | 7.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|