C24H29NO9S — CID 11799762
5-[bis(2-ethoxy-2-oxoethyl)amino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoic acid (PubChem CID 11799762) has the molecular formula C24H29NO9S and a molecular weight of 507.56 g/mol. Its IUPAC name is 5-[bis(2-ethoxy-2-oxoethyl)amino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoic acid.
| Compound Name | 5-[bis(2-ethoxy-2-oxoethyl)amino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11799762 |
| Molecular Formula | C24H29NO9S |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 5-[bis(2-ethoxy-2-oxoethyl)amino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoic acid |
| SMILES | CCOC(=O)CN(CC(=O)OCC)C(=O)C(CCC(=O)O)CS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H29NO9S/c1-3-33-22(28)14-25(15-23(29)34-4-2)24(30)19(10-12-21(26)27)16-35(31,32)20-11-9-17-7-5-6-8-18(17)13-20/h5-9,11,13,19H,3-4,10,12,14-16H2,1-2H3,(H,26,27) |
| InChIKey | PYVQEGGXZRSSPC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 144.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |