C26H27NO3 — CID 118000341
(8R,13aS)-8-benzyl-3-(hydroxymethyl)-10-methoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-ol (PubChem CID 118000341) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is (8R,13aS)-8-benzyl-3-(hydroxymethyl)-10-methoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-ol.
| Compound Name | (8R,13aS)-8-benzyl-3-(hydroxymethyl)-10-methoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-ol |
|---|---|
| PubChem CID | 118000341 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (8R,13aS)-8-benzyl-3-(hydroxymethyl)-10-methoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-ol |
| SMILES | COc1ccc2c(c1O)[C@@H](Cc1ccccc1)N1CCc3cc(CO)ccc3[C@@H]1C2 |
| InChI | InChI=1S/C26H27NO3/c1-30-24-10-8-20-15-22-21-9-7-18(16-28)13-19(21)11-12-27(22)23(25(20)26(24)29)14-17-5-3-2-4-6-17/h2-10,13,22-23,28-29H,11-12,14-16H2,1H3/t22-,23+/m0/s1 |
| InChIKey | KYHMUWJFEMZPAK-XZOQPEGZSA-N |
| XLogP | 4.33 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|