C30H33NO9 — CID 162949254
2-[[3,9-dihydroxy-8-[(4-hydroxyphenyl)methyl]-2-methoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-10-yl]oxy]oxane-3,4,5-triol (PubChem CID 162949254) has the molecular formula C30H33NO9 and a molecular weight of 551.59 g/mol. Its IUPAC name is 2-[[3,9-dihydroxy-8-[(4-hydroxyphenyl)methyl]-2-methoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-10-yl]oxy]oxane-3,4,5-triol.
| Compound Name | 2-[[3,9-dihydroxy-8-[(4-hydroxyphenyl)methyl]-2-methoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-10-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162949254 |
| Molecular Formula | C30H33NO9 |
| Molecular Weight | 551.59 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 2-[[3,9-dihydroxy-8-[(4-hydroxyphenyl)methyl]-2-methoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-10-yl]oxy]oxane-3,4,5-triol |
| SMILES | COc1cc2c(cc1O)CCN1C2Cc2ccc(OC3OCC(O)C(O)C3O)c(O)c2C1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C30H33NO9/c1-38-25-13-19-16(12-22(25)33)8-9-31-20(19)11-17-4-7-24(40-30-29(37)27(35)23(34)14-39-30)28(36)26(17)21(31)10-15-2-5-18(32)6-3-15/h2-7,12-13,20-21,23,27,29-30,32-37H,8-11,14H2,1H3 |
| InChIKey | CPNPZLITCCKDSM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 152.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.59 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|