C30H25N7O — CID 118000376
piperazin-1-yl-[4-[3-[2-[2-(pyridin-3-ylamino)-4-pyridinyl]ethynyl]imidazo[1,2-a]pyridin-6-yl]phenyl]methanone (PubChem CID 118000376) has the molecular formula C30H25N7O and a molecular weight of 499.58 g/mol. Its IUPAC name is piperazin-1-yl-[4-[3-[2-[2-(pyridin-3-ylamino)-4-pyridinyl]ethynyl]imidazo[1,2-a]pyridin-6-yl]phenyl]methanone.
| Compound Name | piperazin-1-yl-[4-[3-[2-[2-(pyridin-3-ylamino)-4-pyridinyl]ethynyl]imidazo[1,2-a]pyridin-6-yl]phenyl]methanone |
|---|---|
| PubChem CID | 118000376 |
| Molecular Formula | C30H25N7O |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | piperazin-1-yl-[4-[3-[2-[2-(pyridin-3-ylamino)-4-pyridinyl]ethynyl]imidazo[1,2-a]pyridin-6-yl]phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc3ncc(C#Cc4ccnc(Nc5cccnc5)c4)n3c2)cc1)N1CCNCC1 |
| InChI | InChI=1S/C30H25N7O/c38-30(36-16-14-31-15-17-36)24-6-4-23(5-7-24)25-8-10-29-34-20-27(37(29)21-25)9-3-22-11-13-33-28(18-22)35-26-2-1-12-32-19-26/h1-2,4-8,10-13,18-21,31H,14-17H2,(H,33,35) |
| InChIKey | QNDUHTHGPCLHOF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|