C28H23N5O2 — CID 137408377
[4-[3-[2-(3-methylbenzimidazol-5-yl)ethynyl]imidazo[1,2-a]pyridin-6-yl]phenyl]-morpholin-4-ylmethanone (PubChem CID 137408377) has the molecular formula C28H23N5O2 and a molecular weight of 461.53 g/mol. Its IUPAC name is [4-[3-[2-(3-methylbenzimidazol-5-yl)ethynyl]imidazo[1,2-a]pyridin-6-yl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[3-[2-(3-methylbenzimidazol-5-yl)ethynyl]imidazo[1,2-a]pyridin-6-yl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 137408377 |
| Molecular Formula | C28H23N5O2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | [4-[3-[2-(3-methylbenzimidazol-5-yl)ethynyl]imidazo[1,2-a]pyridin-6-yl]phenyl]-morpholin-4-ylmethanone |
| SMILES | Cn1cnc2ccc(C#Cc3cnc4ccc(-c5ccc(C(=O)N6CCOCC6)cc5)cn34)cc21 |
| InChI | InChI=1S/C28H23N5O2/c1-31-19-30-25-10-3-20(16-26(25)31)2-9-24-17-29-27-11-8-23(18-33(24)27)21-4-6-22(7-5-21)28(34)32-12-14-35-15-13-32/h3-8,10-11,16-19H,12-15H2,1H3 |
| InChIKey | YKZXJYOCUWFKJI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|