C25H19N7O2 — CID 118000324
morpholin-4-yl-[4-[3-[2-(1H-pyrazolo[3,4-b]pyridin-4-yl)ethynyl]imidazo[1,2-b]pyridazin-6-yl]phenyl]methanone (PubChem CID 118000324) has the molecular formula C25H19N7O2 and a molecular weight of 449.47 g/mol. Its IUPAC name is morpholin-4-yl-[4-[3-[2-(1H-pyrazolo[3,4-b]pyridin-4-yl)ethynyl]imidazo[1,2-b]pyridazin-6-yl]phenyl]methanone.
| Compound Name | morpholin-4-yl-[4-[3-[2-(1H-pyrazolo[3,4-b]pyridin-4-yl)ethynyl]imidazo[1,2-b]pyridazin-6-yl]phenyl]methanone |
|---|---|
| PubChem CID | 118000324 |
| Molecular Formula | C25H19N7O2 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | morpholin-4-yl-[4-[3-[2-(1H-pyrazolo[3,4-b]pyridin-4-yl)ethynyl]imidazo[1,2-b]pyridazin-6-yl]phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc3ncc(C#Cc4ccnc5[nH]ncc45)n3n2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C25H19N7O2/c33-25(31-11-13-34-14-12-31)19-3-1-18(2-4-19)22-7-8-23-27-15-20(32(23)30-22)6-5-17-9-10-26-24-21(17)16-28-29-24/h1-4,7-10,15-16H,11-14H2,(H,26,28,29) |
| InChIKey | CRUWNHAKXPYKCF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|