C24H19N5O2 — CID 118000489
morpholin-4-yl-[4-[3-(2-pyridin-3-ylethynyl)imidazo[1,2-b]pyridazin-6-yl]phenyl]methanone (PubChem CID 118000489) has the molecular formula C24H19N5O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is morpholin-4-yl-[4-[3-(2-pyridin-3-ylethynyl)imidazo[1,2-b]pyridazin-6-yl]phenyl]methanone.
| Compound Name | morpholin-4-yl-[4-[3-(2-pyridin-3-ylethynyl)imidazo[1,2-b]pyridazin-6-yl]phenyl]methanone |
|---|---|
| PubChem CID | 118000489 |
| Molecular Formula | C24H19N5O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | morpholin-4-yl-[4-[3-(2-pyridin-3-ylethynyl)imidazo[1,2-b]pyridazin-6-yl]phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc3ncc(C#Cc4cccnc4)n3n2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C24H19N5O2/c30-24(28-12-14-31-15-13-28)20-6-4-19(5-7-20)22-9-10-23-26-17-21(29(23)27-22)8-3-18-2-1-11-25-16-18/h1-2,4-7,9-11,16-17H,12-15H2 |
| InChIKey | AZQOQYQQPLRSOB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|