C32H30N6O2 — CID 144821576
4-[3-[2-[2-(3-methylanilino)-4-pyridinyl]ethynyl]imidazo[1,2-b]pyridazin-6-yl]benzaldehyde;4-methylmorpholine (PubChem CID 144821576) has the molecular formula C32H30N6O2 and a molecular weight of 530.63 g/mol. Its IUPAC name is 4-[3-[2-[2-(3-methylanilino)-4-pyridinyl]ethynyl]imidazo[1,2-b]pyridazin-6-yl]benzaldehyde;4-methylmorpholine.
| Compound Name | 4-[3-[2-[2-(3-methylanilino)-4-pyridinyl]ethynyl]imidazo[1,2-b]pyridazin-6-yl]benzaldehyde;4-methylmorpholine |
|---|---|
| PubChem CID | 144821576 |
| Molecular Formula | C32H30N6O2 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | 4-[3-[2-[2-(3-methylanilino)-4-pyridinyl]ethynyl]imidazo[1,2-b]pyridazin-6-yl]benzaldehyde;4-methylmorpholine |
| SMILES | CN1CCOCC1.Cc1cccc(Nc2cc(C#Cc3cnc4ccc(-c5ccc(C=O)cc5)nn34)ccn2)c1 |
| InChI | InChI=1S/C27H19N5O.C5H11NO/c1-19-3-2-4-23(15-19)30-26-16-20(13-14-28-26)7-10-24-17-29-27-12-11-25(31-32(24)27)22-8-5-21(18-33)6-9-22;1-6-2-4-7-5-3-6/h2-6,8-9,11-18H,1H3,(H,28,30);2-5H2,1H3 |
| InChIKey | IPOGZNLKUNTCSQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|