C22H21N5O — CID 134808057
N-(4-morpholin-4-ylphenyl)-6-phenylimidazo[1,2-b]pyridazin-3-amine (PubChem CID 134808057) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-6-phenylimidazo[1,2-b]pyridazin-3-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-6-phenylimidazo[1,2-b]pyridazin-3-amine |
|---|---|
| PubChem CID | 134808057 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-6-phenylimidazo[1,2-b]pyridazin-3-amine |
| SMILES | c1ccc(-c2ccc3ncc(Nc4ccc(N5CCOCC5)cc4)n3n2)cc1 |
| InChI | InChI=1S/C22H21N5O/c1-2-4-17(5-3-1)20-10-11-21-23-16-22(27(21)25-20)24-18-6-8-19(9-7-18)26-12-14-28-15-13-26/h1-11,16,24H,12-15H2 |
| InChIKey | OADGIZDOKYLIRM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|