C25H19FN6O4 — CID 140841481
[4-[4-[3-[2-(2-amino-4-pyridinyl)ethynyl]imidazo[1,2-b]pyridazin-6-yl]-2-fluorobenzoyl]morpholin-2-yl] formate (PubChem CID 140841481) has the molecular formula C25H19FN6O4 and a molecular weight of 486.46 g/mol. Its IUPAC name is [4-[4-[3-[2-(2-amino-4-pyridinyl)ethynyl]imidazo[1,2-b]pyridazin-6-yl]-2-fluorobenzoyl]morpholin-2-yl] formate.
| Compound Name | [4-[4-[3-[2-(2-amino-4-pyridinyl)ethynyl]imidazo[1,2-b]pyridazin-6-yl]-2-fluorobenzoyl]morpholin-2-yl] formate |
|---|---|
| PubChem CID | 140841481 |
| Molecular Formula | C25H19FN6O4 |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | [4-[4-[3-[2-(2-amino-4-pyridinyl)ethynyl]imidazo[1,2-b]pyridazin-6-yl]-2-fluorobenzoyl]morpholin-2-yl] formate |
| SMILES | Nc1cc(C#Cc2cnc3ccc(-c4ccc(C(=O)N5CCOC(OC=O)C5)c(F)c4)nn23)ccn1 |
| InChI | InChI=1S/C25H19FN6O4/c26-20-12-17(2-4-19(20)25(34)31-9-10-35-24(14-31)36-15-33)21-5-6-23-29-13-18(32(23)30-21)3-1-16-7-8-28-22(27)11-16/h2,4-8,11-13,15,24H,9-10,14H2,(H2,27,28) |
| InChIKey | DJEZZFWCHZVYKE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|