C28H23N5O2 — CID 167112818
morpholin-4-yl-[4-[6-[2-(1H-pyrazolo[3,4-b]pyridin-4-yl)ethynyl]-8H-quinolizin-3-yl]phenyl]methanone (PubChem CID 167112818) has the molecular formula C28H23N5O2 and a molecular weight of 461.53 g/mol. Its IUPAC name is morpholin-4-yl-[4-[6-[2-(1H-pyrazolo[3,4-b]pyridin-4-yl)ethynyl]-8H-quinolizin-3-yl]phenyl]methanone.
| Compound Name | morpholin-4-yl-[4-[6-[2-(1H-pyrazolo[3,4-b]pyridin-4-yl)ethynyl]-8H-quinolizin-3-yl]phenyl]methanone |
|---|---|
| PubChem CID | 167112818 |
| Molecular Formula | C28H23N5O2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | morpholin-4-yl-[4-[6-[2-(1H-pyrazolo[3,4-b]pyridin-4-yl)ethynyl]-8H-quinolizin-3-yl]phenyl]methanone |
| SMILES | O=C(c1ccc(C2=CN3C(C#Cc4ccnc5[nH]ncc45)=CCC=C3C=C2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C28H23N5O2/c34-28(32-14-16-35-17-15-32)22-6-4-20(5-7-22)23-9-11-25-3-1-2-24(33(25)19-23)10-8-21-12-13-29-27-26(21)18-30-31-27/h2-7,9,11-13,18-19H,1,14-17H2,(H,29,30,31) |
| InChIKey | BRTJPXCMLUJHNG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|