C23H38N5O8P — CID 118004851
butan-2-yl-[1-[(2R,4S,5S)-5-[2,4-dioxo-1-[(1-propan-2-yltriazol-4-yl)methyl]pyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxyphosphinic acid (PubChem CID 118004851) has the molecular formula C23H38N5O8P and a molecular weight of 543.56 g/mol. Its IUPAC name is butan-2-yl-[1-[(2R,4S,5S)-5-[2,4-dioxo-1-[(1-propan-2-yltriazol-4-yl)methyl]pyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxyphosphinic acid.
| Compound Name | butan-2-yl-[1-[(2R,4S,5S)-5-[2,4-dioxo-1-[(1-propan-2-yltriazol-4-yl)methyl]pyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxyphosphinic acid |
|---|---|
| PubChem CID | 118004851 |
| Molecular Formula | C23H38N5O8P |
| Molecular Weight | 543.56 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | butan-2-yl-[1-[(2R,4S,5S)-5-[2,4-dioxo-1-[(1-propan-2-yltriazol-4-yl)methyl]pyrimidin-5-yl]-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxyphosphinic acid |
| SMILES | CCC(C)P(=O)(O)OC(C)(CC)C[C@H]1O[C@@H](c2cn(Cc3cn(C(C)C)nn3)c(=O)[nH]c2=O)[C@@H](O)C1O |
| InChI | InChI=1S/C23H38N5O8P/c1-7-14(5)37(33,34)36-23(6,8-2)9-17-18(29)19(30)20(35-17)16-12-27(22(32)24-21(16)31)10-15-11-28(13(3)4)26-25-15/h11-14,17-20,29-30H,7-10H2,1-6H3,(H,33,34)(H,24,31,32)/t14?,17-,18?,19+,20+,23?/m1/s1 |
| InChIKey | VTJWWWNEBJBULU-QJLAOKQTSA-N |
| XLogP | 1.48 |
| TPSA | 181.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.56 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|