C22H36N5O9P — CID 122544706
[(2R)-1-[(2R,4S,5R)-5-[5-[(1-ethyltriazol-4-yl)methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid (PubChem CID 122544706) has the molecular formula C22H36N5O9P and a molecular weight of 545.53 g/mol. Its IUPAC name is [(2R)-1-[(2R,4S,5R)-5-[5-[(1-ethyltriazol-4-yl)methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid.
| Compound Name | [(2R)-1-[(2R,4S,5R)-5-[5-[(1-ethyltriazol-4-yl)methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid |
|---|---|
| PubChem CID | 122544706 |
| Molecular Formula | C22H36N5O9P |
| Molecular Weight | 545.53 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | [(2R)-1-[(2R,4S,5R)-5-[5-[(1-ethyltriazol-4-yl)methyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(2-hydroxybutan-2-yl)phosphinic acid |
| SMILES | CCn1cc(Cc2cn([C@@H]3O[C@H](C[C@@](C)(CC)OP(=O)(O)C(C)(O)CC)C(O)[C@@H]3O)c(=O)[nH]c2=O)nn1 |
| InChI | InChI=1S/C22H36N5O9P/c1-6-21(4,36-37(33,34)22(5,32)7-2)10-15-16(28)17(29)19(35-15)27-11-13(18(30)23-20(27)31)9-14-12-26(8-3)25-24-14/h11-12,15-17,19,28-29,32H,6-10H2,1-5H3,(H,33,34)(H,23,30,31)/t15-,16?,17+,19-,21-,22?/m1/s1 |
| InChIKey | XCSZHKUMHMKMRK-KETMNPPYSA-N |
| XLogP | 0.24 |
| TPSA | 202.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.53 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|