C19H32N5O8P — CID 122531943
[1-[(2R,3S,4R,5R)-5-(2-amino-1-methyl-6-oxopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-[(2R)-2-hydroxybutan-2-yl]phosphinic acid (PubChem CID 122531943) has the molecular formula C19H32N5O8P and a molecular weight of 489.47 g/mol. Its IUPAC name is [1-[(2R,3S,4R,5R)-5-(2-amino-1-methyl-6-oxopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-[(2R)-2-hydroxybutan-2-yl]phosphinic acid.
| Compound Name | [1-[(2R,3S,4R,5R)-5-(2-amino-1-methyl-6-oxopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-[(2R)-2-hydroxybutan-2-yl]phosphinic acid |
|---|---|
| PubChem CID | 122531943 |
| Molecular Formula | C19H32N5O8P |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | [1-[(2R,3S,4R,5R)-5-(2-amino-1-methyl-6-oxopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-[(2R)-2-hydroxybutan-2-yl]phosphinic acid |
| SMILES | CCC(C)(C[C@H]1O[C@@H](n2cnc3c(=O)n(C)c(N)nc32)[C@H](O)[C@@H]1O)OP(=O)(O)[C@@](C)(O)CC |
| InChI | InChI=1S/C19H32N5O8P/c1-6-18(3,32-33(29,30)19(4,28)7-2)8-10-12(25)13(26)16(31-10)24-9-21-11-14(24)22-17(20)23(5)15(11)27/h9-10,12-13,16,25-26,28H,6-8H2,1-5H3,(H2,20,22)(H,29,30)/t10-,12-,13-,16-,18?,19-/m1/s1 |
| InChIKey | TYOOABDOSHOCMN-RWWULJFHSA-N |
| XLogP | 0.21 |
| TPSA | 195.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|