C18H30N5O8P — CID 118650056
[1-[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(1-hydroxypropyl)phosphinic acid (PubChem CID 118650056) has the molecular formula C18H30N5O8P and a molecular weight of 475.44 g/mol. Its IUPAC name is [1-[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(1-hydroxypropyl)phosphinic acid.
| Compound Name | [1-[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(1-hydroxypropyl)phosphinic acid |
|---|---|
| PubChem CID | 118650056 |
| Molecular Formula | C18H30N5O8P |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | [1-[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(1-hydroxypropyl)phosphinic acid |
| SMILES | CCC(O)P(=O)(O)OC(C)(CC)C[C@H]1O[C@@H](n2cnc3c(OC)nc(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H30N5O8P/c1-5-10(24)32(27,28)31-18(3,6-2)7-9-12(25)13(26)16(30-9)23-8-20-11-14(23)21-17(19)22-15(11)29-4/h8-10,12-13,16,24-26H,5-7H2,1-4H3,(H,27,28)(H2,19,21,22)/t9-,10?,12-,13-,16-,18?/m1/s1 |
| InChIKey | APFXIXLDNKEDAB-VRRBFWNTSA-N |
| XLogP | 0.53 |
| TPSA | 195.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|