C20H34N5O8P — CID 122592772
[1-[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(3-hydroxypentan-3-yl)phosphinic acid (PubChem CID 122592772) has the molecular formula C20H34N5O8P and a molecular weight of 503.49 g/mol. Its IUPAC name is [1-[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(3-hydroxypentan-3-yl)phosphinic acid.
| Compound Name | [1-[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(3-hydroxypentan-3-yl)phosphinic acid |
|---|---|
| PubChem CID | 122592772 |
| Molecular Formula | C20H34N5O8P |
| Molecular Weight | 503.49 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | [1-[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-methylbutan-2-yl]oxy-(3-hydroxypentan-3-yl)phosphinic acid |
| SMILES | CCC(C)(C[C@H]1O[C@@H](n2cnc3c(OC)nc(N)nc32)[C@H](O)[C@@H]1O)OP(=O)(O)C(O)(CC)CC |
| InChI | InChI=1S/C20H34N5O8P/c1-6-19(4,33-34(29,30)20(28,7-2)8-3)9-11-13(26)14(27)17(32-11)25-10-22-12-15(25)23-18(21)24-16(12)31-5/h10-11,13-14,17,26-28H,6-9H2,1-5H3,(H,29,30)(H2,21,23,24)/t11-,13-,14-,17-,19?/m1/s1 |
| InChIKey | QSZCRGLVZYPYMH-BERVYLACSA-N |
| XLogP | 1.31 |
| TPSA | 195.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.49 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|