C21H36N5O8P — CID 163569824
3-[[(2S,3S,4R,5R)-5-(2-amino-1-methyl-6-oxopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]pentan-3-yloxy-(3-hydroxypentan-3-yl)phosphinic acid (PubChem CID 163569824) has the molecular formula C21H36N5O8P and a molecular weight of 517.52 g/mol. Its IUPAC name is 3-[[(2S,3S,4R,5R)-5-(2-amino-1-methyl-6-oxopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]pentan-3-yloxy-(3-hydroxypentan-3-yl)phosphinic acid.
| Compound Name | 3-[[(2S,3S,4R,5R)-5-(2-amino-1-methyl-6-oxopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]pentan-3-yloxy-(3-hydroxypentan-3-yl)phosphinic acid |
|---|---|
| PubChem CID | 163569824 |
| Molecular Formula | C21H36N5O8P |
| Molecular Weight | 517.52 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 3-[[(2S,3S,4R,5R)-5-(2-amino-1-methyl-6-oxopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]pentan-3-yloxy-(3-hydroxypentan-3-yl)phosphinic acid |
| SMILES | CCC(CC)(C[C@@H]1O[C@@H](n2cnc3c(=O)n(C)c(N)nc32)[C@H](O)[C@@H]1O)OP(=O)(O)C(O)(CC)CC |
| InChI | InChI=1S/C21H36N5O8P/c1-6-20(7-2,34-35(31,32)21(30,8-3)9-4)10-12-14(27)15(28)18(33-12)26-11-23-13-16(26)24-19(22)25(5)17(13)29/h11-12,14-15,18,27-28,30H,6-10H2,1-5H3,(H2,22,24)(H,31,32)/t12-,14+,15+,18+/m0/s1 |
| InChIKey | FYJAISKGAWAFDT-KDQZPGIASA-N |
| XLogP | 0.99 |
| TPSA | 195.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.52 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|