C14H16N2O4S — CID 118005077
3-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-1H-1,8-naphthyridine-2-thione (PubChem CID 118005077) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 3-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-1H-1,8-naphthyridine-2-thione.
| Compound Name | 3-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-1H-1,8-naphthyridine-2-thione |
|---|---|
| PubChem CID | 118005077 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-[(2S,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-methyl-1H-1,8-naphthyridine-2-thione |
| SMILES | Cc1ccc2cc([C@@H]3O[C@H](CO)C(O)[C@@H]3O)c(=S)[nH]c2n1 |
| InChI | InChI=1S/C14H16N2O4S/c1-6-2-3-7-4-8(14(21)16-13(7)15-6)12-11(19)10(18)9(5-17)20-12/h2-4,9-12,17-19H,5H2,1H3,(H,15,16,21)/t9-,10?,11+,12+/m1/s1 |
| InChIKey | IEFGPVVHAQVLDO-VIVKNYSDSA-N |
| XLogP | 0.75 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|