C15H17FN2O4S — CID 144823563
3-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-fluoro-5,6-dimethyl-1H-1,8-naphthyridine-2-thione (PubChem CID 144823563) has the molecular formula C15H17FN2O4S and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-fluoro-5,6-dimethyl-1H-1,8-naphthyridine-2-thione.
| Compound Name | 3-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-fluoro-5,6-dimethyl-1H-1,8-naphthyridine-2-thione |
|---|---|
| PubChem CID | 144823563 |
| Molecular Formula | C15H17FN2O4S |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 3-[(2S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-fluoro-5,6-dimethyl-1H-1,8-naphthyridine-2-thione |
| SMILES | Cc1c(F)nc2[nH]c(=S)c([C@@H]3O[C@H](CO)C(O)C3O)cc2c1C |
| InChI | InChI=1S/C15H17FN2O4S/c1-5-6(2)13(16)17-14-7(5)3-8(15(23)18-14)12-11(21)10(20)9(4-19)22-12/h3,9-12,19-21H,4H2,1-2H3,(H,17,18,23)/t9-,10?,11?,12+/m1/s1 |
| InChIKey | TYENOFBACQJIAY-YYJSSNLHSA-N |
| XLogP | 1.20 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|