C27H56O2SiSn — CID 11800971
tri(propan-2-yl)-[[(2S)-6-tributylstannyl-3,4-dihydro-2H-pyran-2-yl]methoxy]silane (PubChem CID 11800971) has the molecular formula C27H56O2SiSn and a molecular weight of 559.54 g/mol. Its IUPAC name is tri(propan-2-yl)-[[(2S)-6-tributylstannyl-3,4-dihydro-2H-pyran-2-yl]methoxy]silane.
| Compound Name | tri(propan-2-yl)-[[(2S)-6-tributylstannyl-3,4-dihydro-2H-pyran-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 11800971 |
| Molecular Formula | C27H56O2SiSn |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | tri(propan-2-yl)-[[(2S)-6-tributylstannyl-3,4-dihydro-2H-pyran-2-yl]methoxy]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=CCC[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C15H29O2Si.3C4H9.Sn/c1-12(2)18(13(3)4,14(5)6)17-11-15-9-7-8-10-16-15;3*1-3-4-2;/h8,12-15H,7,9,11H2,1-6H3;3*1,3-4H2,2H3;/t15-;;;;/m0..../s1 |
| InChIKey | JZVUEFIKKZZLNL-FWELSTJRSA-N |
| XLogP | 9.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|