C33H34N4O5 — CID 11801103
1-O-benzyl 4-O-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] butanedioate (PubChem CID 11801103) has the molecular formula C33H34N4O5 and a molecular weight of 566.66 g/mol. Its IUPAC name is 1-O-benzyl 4-O-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] butanedioate.
| Compound Name | 1-O-benzyl 4-O-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] butanedioate |
|---|---|
| PubChem CID | 11801103 |
| Molecular Formula | C33H34N4O5 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 1-O-benzyl 4-O-[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] butanedioate |
| SMILES | Cc1c2ccnc(C(=O)NCCN(C)C)c2cc2c3cc(OC(=O)CCC(=O)OCc4ccccc4)ccc3n(C)c12 |
| InChI | InChI=1S/C33H34N4O5/c1-21-24-14-15-34-31(33(40)35-16-17-36(2)3)26(24)19-27-25-18-23(10-11-28(25)37(4)32(21)27)42-30(39)13-12-29(38)41-20-22-8-6-5-7-9-22/h5-11,14-15,18-19H,12-13,16-17,20H2,1-4H3,(H,35,40) |
| InChIKey | HWBMEZKQLKINAP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|