About 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol
2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol (PubChem CID 118011779) has the molecular formula C21H16S4
and a molecular weight of 396.63 g/mol. Its IUPAC name is 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol.
Molecular Properties
| Compound Name | 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol |
| PubChem CID | 118011779 |
| Molecular Formula | C21H16S4 |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol |
| SMILES | Cc1ccc2c(S)c(-c3sc4c(sc5cc(C)ccc54)c3C)sc2c1 |
| InChI | InChI=1S/C21H16S4/c1-10-4-6-13-15(8-10)24-21(17(13)22)19-12(3)18-20(25-19)14-7-5-11(2)9-16(14)23-18/h4-9,22H,1-3H3 |
| InChIKey | OFFPJXSXFVXFLK-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol?
The IUPAC name of 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol (CID 118011779) is 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol.
What is the SMILES notation for 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol?
The canonical SMILES for 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol is Cc1ccc2c(S)c(-c3sc4c(sc5cc(C)ccc54)c3C)sc2c1.
What is the InChIKey of 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol?
The InChIKey is OFFPJXSXFVXFLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16S4/c1-10-4-6-13-15(8-10)24-21(17(13)22)19-12(3)18-20(25-19)14-7-5-11(2)9-16(14)23-18/h4-9,22H,1-3H3.
What are the key properties of 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol?
2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol has a molecular weight of 396.63 g/mol, XLogP of 8.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol is sourced from PubChem (CID 118011779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).