C21H16S4 — CID 118011779
2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol (PubChem CID 118011779) has the molecular formula C21H16S4 and a molecular weight of 396.63 g/mol. Its IUPAC name is 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol.
| Compound Name | 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol |
|---|---|
| PubChem CID | 118011779 |
| Molecular Formula | C21H16S4 |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 2-(3,6-dimethylthieno[3,2-b][1]benzothiol-2-yl)-6-methyl-1-benzothiophene-3-thiol |
| SMILES | Cc1ccc2c(S)c(-c3sc4c(sc5cc(C)ccc54)c3C)sc2c1 |
| InChI | InChI=1S/C21H16S4/c1-10-4-6-13-15(8-10)24-21(17(13)22)19-12(3)18-20(25-19)14-7-5-11(2)9-16(14)23-18/h4-9,22H,1-3H3 |
| InChIKey | OFFPJXSXFVXFLK-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|