C28H45N3O5SSi2 — CID 11801590
[(2R,3R)-5-azido-1-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxypentan-2-yl] methanesulfonate (PubChem CID 11801590) has the molecular formula C28H45N3O5SSi2 and a molecular weight of 591.92 g/mol. Its IUPAC name is [(2R,3R)-5-azido-1-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxypentan-2-yl] methanesulfonate.
| Compound Name | [(2R,3R)-5-azido-1-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxypentan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 11801590 |
| Molecular Formula | C28H45N3O5SSi2 |
| Molecular Weight | 591.92 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | [(2R,3R)-5-azido-1-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxypentan-2-yl] methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](OS(C)(=O)=O)[C@@H](CCN=[N+]=[N-])O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H45N3O5SSi2/c1-27(2,3)38(8,9)34-22-26(35-37(7,32)33)25(20-21-30-31-29)36-39(28(4,5)6,23-16-12-10-13-17-23)24-18-14-11-15-19-24/h10-19,25-26H,20-22H2,1-9H3/t25-,26-/m1/s1 |
| InChIKey | MOHUQFWZGLMJGW-CLJLJLNGSA-N |
| XLogP | 6.00 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.92 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|