C27H43N3O3Si2 — CID 10768124
(2R,3R)-5-azido-1-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxypentan-2-ol (PubChem CID 10768124) has the molecular formula C27H43N3O3Si2 and a molecular weight of 513.83 g/mol. Its IUPAC name is (2R,3R)-5-azido-1-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxypentan-2-ol.
| Compound Name | (2R,3R)-5-azido-1-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxypentan-2-ol |
|---|---|
| PubChem CID | 10768124 |
| Molecular Formula | C27H43N3O3Si2 |
| Molecular Weight | 513.83 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | (2R,3R)-5-azido-1-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxypentan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](CCN=[N+]=[N-])O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H43N3O3Si2/c1-26(2,3)34(7,8)32-21-24(31)25(19-20-29-30-28)33-35(27(4,5)6,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,24-25,31H,19-21H2,1-8H3/t24-,25-/m1/s1 |
| InChIKey | DWEWQFBCLYMJJE-JWQCQUIFSA-N |
| XLogP | 6.01 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.83 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|