C23H31N3O5SSi — CID 86750352
[(2R,3R,5S)-5-(azidomethyl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] methanesulfonate (PubChem CID 86750352) has the molecular formula C23H31N3O5SSi and a molecular weight of 489.67 g/mol. Its IUPAC name is [(2R,3R,5S)-5-(azidomethyl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3R,5S)-5-(azidomethyl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 86750352 |
| Molecular Formula | C23H31N3O5SSi |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | [(2R,3R,5S)-5-(azidomethyl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-yl] methanesulfonate |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H](CN=[N+]=[N-])C[C@H]1OS(C)(=O)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O5SSi/c1-23(2,3)33(19-11-7-5-8-12-19,20-13-9-6-10-14-20)29-17-22-21(31-32(4,27)28)15-18(30-22)16-25-26-24/h5-14,18,21-22H,15-17H2,1-4H3/t18-,21+,22+/m0/s1 |
| InChIKey | BSCMOEYOTWEAEX-VLCRHTCISA-N |
| XLogP | 3.38 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|