C25H47NO7 — CID 118016741
10-[2-[2-acetyloxyethyl(methyl)amino]acetyl]oxy-9-hydroxyoctadecanoic acid (PubChem CID 118016741) has the molecular formula C25H47NO7 and a molecular weight of 473.65 g/mol. Its IUPAC name is 10-[2-[2-acetyloxyethyl(methyl)amino]acetyl]oxy-9-hydroxyoctadecanoic acid.
| Compound Name | 10-[2-[2-acetyloxyethyl(methyl)amino]acetyl]oxy-9-hydroxyoctadecanoic acid |
|---|---|
| PubChem CID | 118016741 |
| Molecular Formula | C25H47NO7 |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.34 |
| IUPAC Name | 10-[2-[2-acetyloxyethyl(methyl)amino]acetyl]oxy-9-hydroxyoctadecanoic acid |
| SMILES | CCCCCCCCC(OC(=O)CN(C)CCOC(C)=O)C(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C25H47NO7/c1-4-5-6-7-10-13-16-23(22(28)15-12-9-8-11-14-17-24(29)30)33-25(31)20-26(3)18-19-32-21(2)27/h22-23,28H,4-20H2,1-3H3,(H,29,30) |
| InChIKey | SBICLHYEKSMJKL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|