C26H47NO7 — CID 118016751
methyl (Z)-13-[2-[2-acetyloxyethyl(methyl)amino]acetyl]oxy-12-hydroxyoctadec-9-enoate (PubChem CID 118016751) has the molecular formula C26H47NO7 and a molecular weight of 485.66 g/mol. Its IUPAC name is methyl (Z)-13-[2-[2-acetyloxyethyl(methyl)amino]acetyl]oxy-12-hydroxyoctadec-9-enoate.
| Compound Name | methyl (Z)-13-[2-[2-acetyloxyethyl(methyl)amino]acetyl]oxy-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 118016751 |
| Molecular Formula | C26H47NO7 |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.34 |
| IUPAC Name | methyl (Z)-13-[2-[2-acetyloxyethyl(methyl)amino]acetyl]oxy-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC(OC(=O)CN(C)CCOC(C)=O)C(O)C/C=C\CCCCCCCC(=O)OC |
| InChI | InChI=1S/C26H47NO7/c1-5-6-13-17-24(34-26(31)21-27(3)19-20-33-22(2)28)23(29)16-14-11-9-7-8-10-12-15-18-25(30)32-4/h11,14,23-24,29H,5-10,12-13,15-21H2,1-4H3/b14-11- |
| InChIKey | GQNKZSJJMLKTHX-KAMYIIQDSA-N |
| XLogP | 4.18 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|