C27H50N2O6 — CID 118016825
5-O-[(Z)-18-amino-7-hydroxy-18-oxooctadec-9-en-6-yl] 1-O-[2-(dimethylamino)ethyl] pentanedioate (PubChem CID 118016825) has the molecular formula C27H50N2O6 and a molecular weight of 498.71 g/mol. Its IUPAC name is 5-O-[(Z)-18-amino-7-hydroxy-18-oxooctadec-9-en-6-yl] 1-O-[2-(dimethylamino)ethyl] pentanedioate.
| Compound Name | 5-O-[(Z)-18-amino-7-hydroxy-18-oxooctadec-9-en-6-yl] 1-O-[2-(dimethylamino)ethyl] pentanedioate |
|---|---|
| PubChem CID | 118016825 |
| Molecular Formula | C27H50N2O6 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.37 |
| IUPAC Name | 5-O-[(Z)-18-amino-7-hydroxy-18-oxooctadec-9-en-6-yl] 1-O-[2-(dimethylamino)ethyl] pentanedioate |
| SMILES | CCCCCC(OC(=O)CCCC(=O)OCCN(C)C)C(O)C/C=C\CCCCCCCC(N)=O |
| InChI | InChI=1S/C27H50N2O6/c1-4-5-12-17-24(35-27(33)20-15-19-26(32)34-22-21-29(2)3)23(30)16-13-10-8-6-7-9-11-14-18-25(28)31/h10,13,23-24,30H,4-9,11-12,14-22H2,1-3H3,(H2,28,31)/b13-10- |
| InChIKey | WLRZNUKEITUYNF-RAXLEYEMSA-N |
| XLogP | 4.28 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|