C38H72NO7+ — CID 118330380
2-[5-[(Z)-18-decoxy-7-hydroxy-18-oxooctadec-9-en-6-yl]oxy-5-oxopentanoyl]oxyethyl-trimethylazanium (PubChem CID 118330380) has the molecular formula C38H72NO7+ and a molecular weight of 654.99 g/mol. Its IUPAC name is 2-[5-[(Z)-18-decoxy-7-hydroxy-18-oxooctadec-9-en-6-yl]oxy-5-oxopentanoyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[5-[(Z)-18-decoxy-7-hydroxy-18-oxooctadec-9-en-6-yl]oxy-5-oxopentanoyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 118330380 |
| Molecular Formula | C38H72NO7+ |
| Molecular Weight | 654.99 g/mol |
| Exact Mass | 654.53 |
| IUPAC Name | 2-[5-[(Z)-18-decoxy-7-hydroxy-18-oxooctadec-9-en-6-yl]oxy-5-oxopentanoyl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCCCOC(=O)CCCCCCC/C=C\CC(O)C(CCCCC)OC(=O)CCCC(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C38H72NO7/c1-6-8-10-11-12-17-20-24-32-44-36(41)28-23-19-16-14-13-15-18-22-26-34(40)35(27-21-9-7-2)46-38(43)30-25-29-37(42)45-33-31-39(3,4)5/h18,22,34-35,40H,6-17,19-21,23-33H2,1-5H3/q+1/b22-18- |
| InChIKey | IWTAIEUEOGFLCO-PYCFMQQDSA-N |
| XLogP | 8.62 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.99 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|