C24H43NO6 — CID 118330376
5-O-[(Z)-18-amino-7-hydroxy-18-oxooctadec-9-en-6-yl] 1-O-methyl pentanedioate (PubChem CID 118330376) has the molecular formula C24H43NO6 and a molecular weight of 441.61 g/mol. Its IUPAC name is 5-O-[(Z)-18-amino-7-hydroxy-18-oxooctadec-9-en-6-yl] 1-O-methyl pentanedioate.
| Compound Name | 5-O-[(Z)-18-amino-7-hydroxy-18-oxooctadec-9-en-6-yl] 1-O-methyl pentanedioate |
|---|---|
| PubChem CID | 118330376 |
| Molecular Formula | C24H43NO6 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | 5-O-[(Z)-18-amino-7-hydroxy-18-oxooctadec-9-en-6-yl] 1-O-methyl pentanedioate |
| SMILES | CCCCCC(OC(=O)CCCC(=O)OC)C(O)C/C=C\CCCCCCCC(N)=O |
| InChI | InChI=1S/C24H43NO6/c1-3-4-11-16-21(31-24(29)19-14-18-23(28)30-2)20(26)15-12-9-7-5-6-8-10-13-17-22(25)27/h9,12,20-21,26H,3-8,10-11,13-19H2,1-2H3,(H2,25,27)/b12-9- |
| InChIKey | HARQYMWNSIEPSH-XFXZXTDPSA-N |
| XLogP | 4.34 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|