C40H68Br2O10 — CID 118032810
[(Z)-13-carbonobromidoyloxy-12-hydroxyoctadec-9-enoyl]oxymethyl (Z)-13-(2-bromoacetyl)oxy-12-hydroxyoctadec-9-enoate (PubChem CID 118032810) has the molecular formula C40H68Br2O10 and a molecular weight of 868.78 g/mol. Its IUPAC name is [(Z)-13-carbonobromidoyloxy-12-hydroxyoctadec-9-enoyl]oxymethyl (Z)-13-(2-bromoacetyl)oxy-12-hydroxyoctadec-9-enoate.
| Compound Name | [(Z)-13-carbonobromidoyloxy-12-hydroxyoctadec-9-enoyl]oxymethyl (Z)-13-(2-bromoacetyl)oxy-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 118032810 |
| Molecular Formula | C40H68Br2O10 |
| Molecular Weight | 868.78 g/mol |
| Exact Mass | 866.32 |
| IUPAC Name | [(Z)-13-carbonobromidoyloxy-12-hydroxyoctadec-9-enoyl]oxymethyl (Z)-13-(2-bromoacetyl)oxy-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC(OC(=O)Br)C(O)C/C=C\CCCCCCCC(=O)OCOC(=O)CCCCCCC/C=C\CC(O)C(CCCCC)OC(=O)CBr |
| InChI | InChI=1S/C40H68Br2O10/c1-3-5-19-27-35(51-39(47)31-41)33(43)25-21-15-11-7-9-13-17-23-29-37(45)49-32-50-38(46)30-24-18-14-10-8-12-16-22-26-34(44)36(52-40(42)48)28-20-6-4-2/h15-16,21-22,33-36,43-44H,3-14,17-20,23-32H2,1-2H3/b21-15-,22-16- |
| InChIKey | BHHSFVOPUHYHMV-BMJUYKDLSA-N |
| XLogP | 10.47 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.78 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|