C40H74NO9+ — CID 118013071
2-acetyloxyethyl-[2-[7-hydroxy-18-(6-octanoyloxyhexoxy)-18-oxooctadec-9-en-6-yl]oxy-2-oxoethyl]-dimethylazanium (PubChem CID 118013071) has the molecular formula C40H74NO9+ and a molecular weight of 713.03 g/mol. Its IUPAC name is 2-acetyloxyethyl-[2-[7-hydroxy-18-(6-octanoyloxyhexoxy)-18-oxooctadec-9-en-6-yl]oxy-2-oxoethyl]-dimethylazanium.
| Compound Name | 2-acetyloxyethyl-[2-[7-hydroxy-18-(6-octanoyloxyhexoxy)-18-oxooctadec-9-en-6-yl]oxy-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 118013071 |
| Molecular Formula | C40H74NO9+ |
| Molecular Weight | 713.03 g/mol |
| Exact Mass | 712.54 |
| IUPAC Name | 2-acetyloxyethyl-[2-[7-hydroxy-18-(6-octanoyloxyhexoxy)-18-oxooctadec-9-en-6-yl]oxy-2-oxoethyl]-dimethylazanium |
| SMILES | CCCCCCCC(=O)OCCCCCCOC(=O)CCCCCCCC=CCC(O)C(CCCCC)OC(=O)C[N+](C)(C)CCOC(C)=O |
| InChI | InChI=1S/C40H74NO9/c1-6-8-10-15-22-28-38(44)48-31-24-18-19-25-32-49-39(45)29-23-17-14-12-11-13-16-21-26-36(43)37(27-20-9-7-2)50-40(46)34-41(4,5)30-33-47-35(3)42/h16,21,36-37,43H,6-15,17-20,22-34H2,1-5H3/q+1 |
| InChIKey | VBRYIBSVIREVEU-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.03 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|