C30H56N3O7+ — CID 123933962
[2-[18-(2-acetamidoethylamino)-7-hydroxy-18-oxooctadec-9-en-6-yl]oxy-2-oxoethyl]-(2-acetyloxyethyl)-dimethylazanium (PubChem CID 123933962) has the molecular formula C30H56N3O7+ and a molecular weight of 570.79 g/mol. Its IUPAC name is [2-[18-(2-acetamidoethylamino)-7-hydroxy-18-oxooctadec-9-en-6-yl]oxy-2-oxoethyl]-(2-acetyloxyethyl)-dimethylazanium.
| Compound Name | [2-[18-(2-acetamidoethylamino)-7-hydroxy-18-oxooctadec-9-en-6-yl]oxy-2-oxoethyl]-(2-acetyloxyethyl)-dimethylazanium |
|---|---|
| PubChem CID | 123933962 |
| Molecular Formula | C30H56N3O7+ |
| Molecular Weight | 570.79 g/mol |
| Exact Mass | 570.41 |
| IUPAC Name | [2-[18-(2-acetamidoethylamino)-7-hydroxy-18-oxooctadec-9-en-6-yl]oxy-2-oxoethyl]-(2-acetyloxyethyl)-dimethylazanium |
| SMILES | CCCCCC(OC(=O)C[N+](C)(C)CCOC(C)=O)C(O)CC=CCCCCCCCC(=O)NCCNC(C)=O |
| InChI | InChI=1S/C30H55N3O7/c1-6-7-14-18-28(40-30(38)24-33(4,5)22-23-39-26(3)35)27(36)17-15-12-10-8-9-11-13-16-19-29(37)32-21-20-31-25(2)34/h12,15,27-28,36H,6-11,13-14,16-24H2,1-5H3,(H-,31,32,34,37)/p+1 |
| InChIKey | RGYPUUUCODJOKL-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.79 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|