C36H68NO7+ — CID 123895854
2-acetyloxyethyl-[2-(18-decoxy-7-hydroxy-18-oxooctadec-9-en-6-yl)oxy-2-oxoethyl]-dimethylazanium (PubChem CID 123895854) has the molecular formula C36H68NO7+ and a molecular weight of 626.94 g/mol. Its IUPAC name is 2-acetyloxyethyl-[2-(18-decoxy-7-hydroxy-18-oxooctadec-9-en-6-yl)oxy-2-oxoethyl]-dimethylazanium.
| Compound Name | 2-acetyloxyethyl-[2-(18-decoxy-7-hydroxy-18-oxooctadec-9-en-6-yl)oxy-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 123895854 |
| Molecular Formula | C36H68NO7+ |
| Molecular Weight | 626.94 g/mol |
| Exact Mass | 626.50 |
| IUPAC Name | 2-acetyloxyethyl-[2-(18-decoxy-7-hydroxy-18-oxooctadec-9-en-6-yl)oxy-2-oxoethyl]-dimethylazanium |
| SMILES | CCCCCCCCCCOC(=O)CCCCCCCC=CCC(O)C(CCCCC)OC(=O)C[N+](C)(C)CCOC(C)=O |
| InChI | InChI=1S/C36H68NO7/c1-6-8-10-11-12-17-20-24-29-43-35(40)27-23-19-16-14-13-15-18-22-25-33(39)34(26-21-9-7-2)44-36(41)31-37(4,5)28-30-42-32(3)38/h18,22,33-34,39H,6-17,19-21,23-31H2,1-5H3/q+1 |
| InChIKey | FZCVFOVAGDCHKL-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.94 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|