C43H82Cl2N4O9 — CID 159008497
2-acetyloxyethyl-[10-[[(Z)-13-[2-[2-acetyloxyethyl(dimethyl)azaniumyl]acetyl]oxy-12-hydroxyoctadec-9-enoyl]amino]decylcarbamoyl]-dimethylazanium dichloride (PubChem CID 159008497) has the molecular formula C43H82Cl2N4O9 and a molecular weight of 870.05 g/mol. Its IUPAC name is 2-acetyloxyethyl-[10-[[(Z)-13-[2-[2-acetyloxyethyl(dimethyl)azaniumyl]acetyl]oxy-12-hydroxyoctadec-9-enoyl]amino]decylcarbamoyl]-dimethylazanium dichloride.
| Compound Name | 2-acetyloxyethyl-[10-[[(Z)-13-[2-[2-acetyloxyethyl(dimethyl)azaniumyl]acetyl]oxy-12-hydroxyoctadec-9-enoyl]amino]decylcarbamoyl]-dimethylazanium dichloride |
|---|---|
| PubChem CID | 159008497 |
| Molecular Formula | C43H82Cl2N4O9 |
| Molecular Weight | 870.05 g/mol |
| Exact Mass | 868.55 |
| IUPAC Name | 2-acetyloxyethyl-[10-[[(Z)-13-[2-[2-acetyloxyethyl(dimethyl)azaniumyl]acetyl]oxy-12-hydroxyoctadec-9-enoyl]amino]decylcarbamoyl]-dimethylazanium dichloride |
| SMILES | CCCCCC(OC(=O)C[N+](C)(C)CCOC(C)=O)C(O)C/C=C\CCCCCCCC(=O)NCCCCCCCCCCNC(=O)[N+](C)(C)CCOC(C)=O.[Cl-].[Cl-] |
| InChI | InChI=1S/C43H80N4O9.2ClH/c1-8-9-22-28-40(56-42(52)36-46(4,5)32-34-54-37(2)48)39(50)27-23-18-14-10-11-15-19-24-29-41(51)44-30-25-20-16-12-13-17-21-26-31-45-43(53)47(6,7)33-35-55-38(3)49;;/h18,23,39-40,50H,8-17,19-22,24-36H2,1-7H3;2*1H/b23-18-;; |
| InChIKey | NEZCYGZXMRRVFM-GWVWRDIQSA-N |
| XLogP | 0.75 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 58 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.05 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|